Which one of the following minerals is used as a fuel in nuclear power stations?
Bauxite
Quartz
Feldspa
Pitchblende
Which one of the following is NOT a synthetic detergent?
CH3(CH2)10CH2OSO3-Na+
[CH3(CH2)15- N -(CH3)3]+BR-
CH3(CH2)16COO-Na+
CH3(CH2)16COO(CH2CH2O)nCH2CH2OH
Which one of the following metals does NOT react with cold water?
Calcium (Ca)
Potassium (K)
Magnesium (Mg)
Sodium (Na)
Which one of the following is used as a binder in paints?
Titanium dioxide
Novolac
Phthalocyanine
Silicones
Basic scientific principle behind a nuclear reactor is
Nuclear fusion
Controlled nuclear fusion
Uncontrolled nuclear fission
Controlled nuclear fission
Which one of the following statements is NOT correct for the given reaction?
Fe(s) + CuSO4(aq) → FeSO4(aq) + Cu(s)
Iron is the reducing agent
The solution turns green in colour after the reaction
Copper is a more reactive metal than iron
The reaction is an example of a redox reaction
Which one of the following is an organic acid?
Hydrochloric acid
Nitric acid
Acetic acid
Sulphuric acid
Dinitrogen (N2) and dioxygen (O2) are the main constituents of air but they do not react with each other to form oxides of nitrogen because:
The reaction requires initiation by a catalyst
Oxides of nitrogen are unstable
The reaction is endothermic and requires very high temperature
The stoichiometry of N2 and O2 in air is not ideal for the reaction to take place
C.
The reaction is endothermic and requires very high temperature